Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, Recommanded Product: 1-(Bromomethyl)-2-nitrobenzene, 3958-60-9, Name is 1-(Bromomethyl)-2-nitrobenzene, SMILES is C1=CC=CC(=C1CBr)[N+](=O)[O-], belongs to bromides-buliding-blocks compound. In a document, author is Seong, Chaehyeon, introduce the new discover.
Total Synthesis of 1-Oxomiltirone and Arucadiol
A practical and efficient approach for the total synthesis of arucadiol and 1-oxomiltirone is reported. The key step which involves an intramolecular [4+2] cycloaddition catalyzed by gold(III) bromide or copper(II) triflate leads to the formation of 6-6-6-fused aromatic abietane core.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 3958-60-9. Recommanded Product: 1-(Bromomethyl)-2-nitrobenzene.