Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, Safety of Methyl 2-(bromomethyl)-3-nitrobenzoate, 98475-07-1, Name is Methyl 2-(bromomethyl)-3-nitrobenzoate, SMILES is O=C(OC)C1=CC=CC([N+]([O-])=O)=C1CBr, belongs to bromides-buliding-blocks compound. In a document, author is Li, Hua, introduce the new discover.
Solvothermal synthesis and modification of NaYF4:Yb/Er@NaLuF4:Yb for enhanced up-conversion luminescence for bioimaging
Water-soluble NaYF4:Yb/Er@NaLuF4:Yb up-converting nanoparticles (UCNPs) with a strong green emission were successfully prepared by a solvothermal method in a short period of time and at a low temperature. First, the hydrophobic UCNPs were prepared by a simple solvothermal method, then modified using a polyetherimide (PEI) surfactant or oxidation of the oleic acid ligands with the Lemieux-von Rudloff reagent. The modified UCNPs, having an average particle diameter of 60 +/- 5 nm, showed a high dispersity. The oleic acid ligand on the sample surface was oxidized azelaic acid (HOOC(CH2)(7)COOH), identified from Fourier transform infrared (FTIR) spectroscopy, which results in the generation of free carboxylic acid, hence conferring a high solubility in water. The 3-4,5-dimethylthiazol-2-yl-2,5-diphenyl tetrazolium bromide (MTT) method and cell-targeted labeling proved that oleic acid-capped UCNPs after oxidation (UCNPs-OAO) have a higher biocompatibility than polyetherimide-capped UCNPs (UCNPs-PEI). Therefore, the UCNPs-OAO have a great potential in biomedical applications, such as multimodal imaging, targeted therapy, and gene therapy.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 98475-07-1. Safety of Methyl 2-(bromomethyl)-3-nitrobenzoate.